C24H42O3S2Si2 — CID 10929180
(6aR,9aS)-8-benzylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 10929180) has the molecular formula C24H42O3S2Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is (6aR,9aS)-8-benzylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | (6aR,9aS)-8-benzylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 10929180 |
| Molecular Formula | C24H42O3S2Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (6aR,9aS)-8-benzylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2SC(SCc3ccccc3)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C24H42O3S2Si2/c1-17(2)30(18(3)4)25-15-23-22(26-31(27-30,19(5)6)20(7)8)14-24(29-23)28-16-21-12-10-9-11-13-21/h9-13,17-20,22-24H,14-16H2,1-8H3/t22-,23+,24?/m0/s1 |
| InChIKey | IXMCPWSZUHEDNS-XAGPSQNTSA-N |
| XLogP | 7.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|