C12H17Br3Cl2O2 — CID 10929234
[(E)-2,8,8-tribromo-1,7-dichloro-2,6-dimethyloct-5-en-3-yl] acetate (PubChem CID 10929234) has the molecular formula C12H17Br3Cl2O2 and a molecular weight of 503.88 g/mol. Its IUPAC name is [(E)-2,8,8-tribromo-1,7-dichloro-2,6-dimethyloct-5-en-3-yl] acetate.
| Compound Name | [(E)-2,8,8-tribromo-1,7-dichloro-2,6-dimethyloct-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 10929234 |
| Molecular Formula | C12H17Br3Cl2O2 |
| Molecular Weight | 503.88 g/mol |
| Exact Mass | 499.82 |
| IUPAC Name | [(E)-2,8,8-tribromo-1,7-dichloro-2,6-dimethyloct-5-en-3-yl] acetate |
| SMILES | CC(=O)OC(C/C=C(\C)C(Cl)C(Br)Br)C(C)(Br)CCl |
| InChI | InChI=1S/C12H17Br3Cl2O2/c1-7(10(17)11(13)14)4-5-9(19-8(2)18)12(3,15)6-16/h4,9-11H,5-6H2,1-3H3/b7-4+ |
| InChIKey | DTCZNJROCVEBBU-QPJJXVBHSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.88 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|