C30H41NO4Si — CID 10929279
tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-oxobutyl)-2,3-dihydropyrrole-1-carboxylate (PubChem CID 10929279) has the molecular formula C30H41NO4Si and a molecular weight of 507.75 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-oxobutyl)-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-oxobutyl)-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10929279 |
| Molecular Formula | C30H41NO4Si |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-oxobutyl)-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(=O)CC[C@H]1C=CN(C(=O)OC(C)(C)C)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H41NO4Si/c1-23(32)18-19-24-20-21-31(28(33)35-29(2,3)4)27(24)22-34-36(30(5,6)7,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,20-21,24,27H,18-19,22H2,1-7H3/t24-,27+/m0/s1 |
| InChIKey | BFZYPAKLROZEMS-RPLLCQBOSA-N |
| XLogP | 5.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|