C25H42N4O7 — CID 10929318
(3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-3,3-dimethylpyrrolidine-2-carbonyl]amino]-2-oxoheptanoic acid (PubChem CID 10929318) has the molecular formula C25H42N4O7 and a molecular weight of 510.63 g/mol. Its IUPAC name is (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-3,3-dimethylpyrrolidine-2-carbonyl]amino]-2-oxoheptanoic acid.
| Compound Name | (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-3,3-dimethylpyrrolidine-2-carbonyl]amino]-2-oxoheptanoic acid |
|---|---|
| PubChem CID | 10929318 |
| Molecular Formula | C25H42N4O7 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-3,3-dimethylpyrrolidine-2-carbonyl]amino]-2-oxoheptanoic acid |
| SMILES | CC1(C)CCN(C(=O)[C@@H](CC2CCCCC2)NCC(=O)O)[C@@H]1C(=O)N[C@@H](CCCCN)C(=O)C(=O)O |
| InChI | InChI=1S/C25H42N4O7/c1-25(2)11-13-29(21(25)22(33)28-17(10-6-7-12-26)20(32)24(35)36)23(34)18(27-15-19(30)31)14-16-8-4-3-5-9-16/h16-18,21,27H,3-15,26H2,1-2H3,(H,28,33)(H,30,31)(H,35,36)/t17-,18+,21+/m0/s1 |
| InChIKey | QRPCKZKAIDYUFX-WAOWUJCRSA-N |
| XLogP | 0.89 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|