C28H54O4Si2 — CID 10929322
[(E,3S)-1-[(1R,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclopentyl]oct-1-en-3-yl] acetate (PubChem CID 10929322) has the molecular formula C28H54O4Si2 and a molecular weight of 510.91 g/mol. Its IUPAC name is [(E,3S)-1-[(1R,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclopentyl]oct-1-en-3-yl] acetate.
| Compound Name | [(E,3S)-1-[(1R,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclopentyl]oct-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 10929322 |
| Molecular Formula | C28H54O4Si2 |
| Molecular Weight | 510.91 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | [(E,3S)-1-[(1R,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclopentyl]oct-1-en-3-yl] acetate |
| SMILES | C=C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/[C@H](CCCCC)OC(C)=O |
| InChI | InChI=1S/C28H54O4Si2/c1-14-15-16-17-23(30-22(3)29)18-19-24-21(2)25(31-33(10,11)27(4,5)6)20-26(24)32-34(12,13)28(7,8)9/h18-19,23-26H,2,14-17,20H2,1,3-13H3/b19-18+/t23-,24+,25-,26+/m0/s1 |
| InChIKey | DXLWVLFMBFAXBT-FRRVUTTGSA-N |
| XLogP | 8.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.91 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|