C25H43N2O7P — CID 10929352
2-cyanoethyl [(3R,4S,5S,8S)-3-hydroxy-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-yn-5-yl] phosphate;triethylazanium (PubChem CID 10929352) has the molecular formula C25H43N2O7P and a molecular weight of 514.60 g/mol. Its IUPAC name is 2-cyanoethyl [(3R,4S,5S,8S)-3-hydroxy-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-yn-5-yl] phosphate;triethylazanium.
| Compound Name | 2-cyanoethyl [(3R,4S,5S,8S)-3-hydroxy-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-yn-5-yl] phosphate;triethylazanium |
|---|---|
| PubChem CID | 10929352 |
| Molecular Formula | C25H43N2O7P |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 2-cyanoethyl [(3R,4S,5S,8S)-3-hydroxy-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-yn-5-yl] phosphate;triethylazanium |
| SMILES | C#C[C@H](O)[C@H](C)[C@H](CC[C@H](C)[C@@H]1OC(=O)C=C[C@@H]1C)OP(=O)([O-])OCCC#N.CC[NH+](CC)CC |
| InChI | InChI=1S/C19H28NO7P.C6H15N/c1-5-16(21)15(4)17(27-28(23,24)25-12-6-11-20)9-7-13(2)19-14(3)8-10-18(22)26-19;1-4-7(5-2)6-3/h1,8,10,13-17,19,21H,6-7,9,12H2,2-4H3,(H,23,24);4-6H2,1-3H3/t13-,14-,15-,16-,17-,19-;/m0./s1 |
| InChIKey | HPVDUAIKAZVNNI-ZSRBRGKJSA-N |
| XLogP | 1.87 |
| TPSA | 133.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|