C21H23N5O2 — CID 109293760
N-[4-(dimethylamino)phenyl]-5-(4-ethoxyanilino)pyrazine-2-carboxamide (PubChem CID 109293760) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-5-(4-ethoxyanilino)pyrazine-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-5-(4-ethoxyanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109293760 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-5-(4-ethoxyanilino)pyrazine-2-carboxamide |
| SMILES | CCOc1ccc(Nc2cnc(C(=O)Nc3ccc(N(C)C)cc3)cn2)cc1 |
| InChI | InChI=1S/C21H23N5O2/c1-4-28-18-11-7-15(8-12-18)24-20-14-22-19(13-23-20)21(27)25-16-5-9-17(10-6-16)26(2)3/h5-14H,4H2,1-3H3,(H,23,24)(H,25,27) |
| InChIKey | HQVWEBFGYNLWOZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|