C20H18F2N4O2 — CID 109293851
N-(2,4-difluorophenyl)-5-(2-propan-2-yloxyanilino)pyrazine-2-carboxamide (PubChem CID 109293851) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(2-propan-2-yloxyanilino)pyrazine-2-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-(2-propan-2-yloxyanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109293851 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(2-propan-2-yloxyanilino)pyrazine-2-carboxamide |
| SMILES | CC(C)Oc1ccccc1Nc1cnc(C(=O)Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-12(2)28-18-6-4-3-5-16(18)25-19-11-23-17(10-24-19)20(27)26-15-8-7-13(21)9-14(15)22/h3-12H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | WSWNDTCZTBGMBN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |