About N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide
N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 10929431) has the molecular formula C28H34N4O2S2
and a molecular weight of 522.74 g/mol. Its IUPAC name is N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide.
Molecular Properties
| Compound Name | N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide |
| PubChem CID | 10929431 |
| Molecular Formula | C28H34N4O2S2 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCCCCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C28H34N4O2S2/c33-28(13-3-2-10-23-14-19-35-36-23)31-17-6-1-9-18-34-22-20-26(24-11-4-7-15-29-24)32-27(21-22)25-12-5-8-16-30-25/h4-5,7-8,11-12,15-16,20-21,23H,1-3,6,9-10,13-14,17-19H2,(H,31,33) |
| InChIKey | ARUAUMNXEPHORN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide?
The IUPAC name of N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide (CID 10929431) is N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide.
What is the SMILES notation for N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide?
The canonical SMILES for N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide is O=C(CCCCC1CCSS1)NCCCCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1.
What is the InChIKey of N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide?
The InChIKey is ARUAUMNXEPHORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N4O2S2/c33-28(13-3-2-10-23-14-19-35-36-23)31-17-6-1-9-18-34-22-20-26(24-11-4-7-15-29-24)32-27(21-22)25-12-5-8-16-30-25/h4-5,7-8,11-12,15-16,20-21,23H,1-3,6,9-10,13-14,17-19H2,(H,31,33).
What are the key properties of N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide?
N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide has a molecular weight of 522.74 g/mol, XLogP of 6.59, 14 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]pentyl]-5-(dithiolan-3-yl)pentanamide is sourced from PubChem (CID 10929431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).