C31H33N3O5 — CID 10929479
2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10929479) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10929479 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | O=C1[C@H](Cc2ccccc2)N2C(=O)CCN(C(=O)OCCc3ccc(O)cc3)[C@H]2CN1CCc1ccccc1 |
| InChI | InChI=1S/C31H33N3O5/c35-26-13-11-24(12-14-26)17-20-39-31(38)33-19-16-29(36)34-27(21-25-9-5-2-6-10-25)30(37)32(22-28(33)34)18-15-23-7-3-1-4-8-23/h1-14,27-28,35H,15-22H2/t27-,28+/m0/s1 |
| InChIKey | BNERQRVRBURSAT-WUFINQPMSA-N |
| XLogP | 3.63 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |