C15H17ClN4O — CID 109294844
N-(3-chloro-4-methylphenyl)-2-(propylamino)pyrimidine-4-carboxamide (PubChem CID 109294844) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(propylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(propylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109294844 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(propylamino)pyrimidine-4-carboxamide |
| SMILES | CCCNc1nccc(C(=O)Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H17ClN4O/c1-3-7-17-15-18-8-6-13(20-15)14(21)19-11-5-4-10(2)12(16)9-11/h4-6,8-9H,3,7H2,1-2H3,(H,19,21)(H,17,18,20) |
| InChIKey | DDGSFWBIRYRICR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |