C16H18N4O3 — CID 109295653
2-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 109295653) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109295653 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccnc(NC3CC3)n2)c1 |
| InChI | InChI=1S/C16H18N4O3/c1-22-11-5-6-14(23-2)13(9-11)19-15(21)12-7-8-17-16(20-12)18-10-3-4-10/h5-10H,3-4H2,1-2H3,(H,19,21)(H,17,18,20) |
| InChIKey | PUQDXXJRUXFHBK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |