C31H54O7 — CID 10929576
(E,3S,8R)-8-(methoxymethoxy)-8-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]oct-6-en-1-yn-3-ol (PubChem CID 10929576) has the molecular formula C31H54O7 and a molecular weight of 538.77 g/mol. Its IUPAC name is (E,3S,8R)-8-(methoxymethoxy)-8-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]oct-6-en-1-yn-3-ol.
| Compound Name | (E,3S,8R)-8-(methoxymethoxy)-8-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]oct-6-en-1-yn-3-ol |
|---|---|
| PubChem CID | 10929576 |
| Molecular Formula | C31H54O7 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | (E,3S,8R)-8-(methoxymethoxy)-8-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]oct-6-en-1-yn-3-ol |
| SMILES | C#C[C@@H](O)CC/C=C/[C@@H](OCOC)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCCCCCCC)OCOC)O2)O1 |
| InChI | InChI=1S/C31H54O7/c1-5-7-8-9-10-11-12-13-17-26(35-23-33-3)28-19-21-30(37-28)31-22-20-29(38-31)27(36-24-34-4)18-15-14-16-25(32)6-2/h2,15,18,25-32H,5,7-14,16-17,19-24H2,1,3-4H3/b18-15+/t25-,26-,27-,28-,29-,30-,31-/m1/s1 |
| InChIKey | UDPWGEDQNUGHIK-BXAYCAQVSA-N |
| XLogP | 5.92 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|