C16H23N5O3 — CID 109295773
ethyl 4-[[4-(cyclopropylcarbamoyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 109295773) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethyl 4-[[4-(cyclopropylcarbamoyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(cyclopropylcarbamoyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109295773 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | ethyl 4-[[4-(cyclopropylcarbamoyl)pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nccc(C(=O)NC3CC3)n2)CC1 |
| InChI | InChI=1S/C16H23N5O3/c1-2-24-16(23)21-9-6-12(7-10-21)19-15-17-8-5-13(20-15)14(22)18-11-3-4-11/h5,8,11-12H,2-4,6-7,9-10H2,1H3,(H,18,22)(H,17,19,20) |
| InChIKey | XVTMCPOIPVUTOT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |