C19H23N5O — CID 109295973
[4-(3-methylphenyl)piperazin-1-yl]-[2-(prop-2-enylamino)pyrimidin-4-yl]methanone (PubChem CID 109295973) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is [4-(3-methylphenyl)piperazin-1-yl]-[2-(prop-2-enylamino)pyrimidin-4-yl]methanone.
| Compound Name | [4-(3-methylphenyl)piperazin-1-yl]-[2-(prop-2-enylamino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109295973 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [4-(3-methylphenyl)piperazin-1-yl]-[2-(prop-2-enylamino)pyrimidin-4-yl]methanone |
| SMILES | C=CCNc1nccc(C(=O)N2CCN(c3cccc(C)c3)CC2)n1 |
| InChI | InChI=1S/C19H23N5O/c1-3-8-20-19-21-9-7-17(22-19)18(25)24-12-10-23(11-13-24)16-6-4-5-15(2)14-16/h3-7,9,14H,1,8,10-13H2,2H3,(H,20,21,22) |
| InChIKey | MHRKITVDCVMCOJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|