C25H43IO3Si — CID 10929649
tert-butyl-[(Z,2S)-7-(1,3-dioxolan-2-yl)-4-iodo-1-[(1R)-4-methyl-7-methylidenecyclohept-3-en-1-yl]hept-3-en-2-yl]oxy-dimethylsilane (PubChem CID 10929649) has the molecular formula C25H43IO3Si and a molecular weight of 546.61 g/mol. Its IUPAC name is tert-butyl-[(Z,2S)-7-(1,3-dioxolan-2-yl)-4-iodo-1-[(1R)-4-methyl-7-methylidenecyclohept-3-en-1-yl]hept-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S)-7-(1,3-dioxolan-2-yl)-4-iodo-1-[(1R)-4-methyl-7-methylidenecyclohept-3-en-1-yl]hept-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10929649 |
| Molecular Formula | C25H43IO3Si |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | tert-butyl-[(Z,2S)-7-(1,3-dioxolan-2-yl)-4-iodo-1-[(1R)-4-methyl-7-methylidenecyclohept-3-en-1-yl]hept-3-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C1CCC(C)=CC[C@@H]1C[C@@H](/C=C(\I)CCCC1OCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H43IO3Si/c1-19-11-13-20(2)21(14-12-19)17-23(29-30(6,7)25(3,4)5)18-22(26)9-8-10-24-27-15-16-28-24/h12,18,21,23-24H,2,8-11,13-17H2,1,3-7H3/b22-18-/t21-,23+/m1/s1 |
| InChIKey | JHUTWKNUFNFRGH-WKHBMQPXSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|