C15H16F2N4O — CID 109296690
N-butyl-2-(2,6-difluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109296690) has the molecular formula C15H16F2N4O and a molecular weight of 306.32 g/mol. Its IUPAC name is N-butyl-2-(2,6-difluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-butyl-2-(2,6-difluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109296690 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-butyl-2-(2,6-difluoroanilino)pyrimidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1ccnc(Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C15H16F2N4O/c1-2-3-8-18-14(22)12-7-9-19-15(20-12)21-13-10(16)5-4-6-11(13)17/h4-7,9H,2-3,8H2,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | VMJDMJFHSGHXLW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|