C15H19N5O — CID 109296920
N-(2-methylpropyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109296920) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-methylpropyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109296920 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-(2-methylpropyl)-2-(pyridin-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)c1ccnc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C15H19N5O/c1-11(2)9-18-14(21)13-6-8-17-15(20-13)19-10-12-5-3-4-7-16-12/h3-8,11H,9-10H2,1-2H3,(H,18,21)(H,17,19,20) |
| InChIKey | XLSICAUUBGSZNV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |