C26H52O3SiSn — CID 10929752
butyl (2E,5S,6E)-7-tributylstannyl-5-trimethylsilyloxyhepta-2,6-dienoate (PubChem CID 10929752) has the molecular formula C26H52O3SiSn and a molecular weight of 559.50 g/mol. Its IUPAC name is butyl (2E,5S,6E)-7-tributylstannyl-5-trimethylsilyloxyhepta-2,6-dienoate.
| Compound Name | butyl (2E,5S,6E)-7-tributylstannyl-5-trimethylsilyloxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 10929752 |
| Molecular Formula | C26H52O3SiSn |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | butyl (2E,5S,6E)-7-tributylstannyl-5-trimethylsilyloxyhepta-2,6-dienoate |
| SMILES | CCCCOC(=O)/C=C/C[C@@H](/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C14H25O3Si.3C4H9.Sn/c1-6-8-12-16-14(15)11-9-10-13(7-2)17-18(3,4)5;3*1-3-4-2;/h2,7,9,11,13H,6,8,10,12H2,1,3-5H3;3*1,3-4H2,2H3;/b7-2?,11-9+;;;;/t13-;;;;/m1..../s1 |
| InChIKey | AGOOGWMDTRPEAW-SNFHSNRCSA-N |
| XLogP | 8.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|