C22H22N4O2 — CID 109297617
N-(4-phenylmethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 109297617) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-(4-phenylmethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | N-(4-phenylmethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109297617 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-(4-phenylmethoxyphenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)c1ccnc(N2CCCC2)n1 |
| InChI | InChI=1S/C22H22N4O2/c27-21(20-12-13-23-22(25-20)26-14-4-5-15-26)24-18-8-10-19(11-9-18)28-16-17-6-2-1-3-7-17/h1-3,6-13H,4-5,14-16H2,(H,24,27) |
| InChIKey | QSVBLYPIZRFUEI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |