C22H22N4O2 — CID 109298011
2-(cyclopentylamino)-N-(2-phenoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 109298011) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-(cyclopentylamino)-N-(2-phenoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(cyclopentylamino)-N-(2-phenoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109298011 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-(cyclopentylamino)-N-(2-phenoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)c1ccnc(NC2CCCC2)n1 |
| InChI | InChI=1S/C22H22N4O2/c27-21(19-14-15-23-22(26-19)24-16-8-4-5-9-16)25-18-12-6-7-13-20(18)28-17-10-2-1-3-11-17/h1-3,6-7,10-16H,4-5,8-9H2,(H,25,27)(H,23,24,26) |
| InChIKey | RENOEKUVGMGVAS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |