C31H60O3Si3 — CID 10929810
(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one (PubChem CID 10929810) has the molecular formula C31H60O3Si3 and a molecular weight of 565.08 g/mol. Its IUPAC name is (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 10929810 |
| Molecular Formula | C31H60O3Si3 |
| Molecular Weight | 565.08 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H60O3Si3/c1-15-16-17-19-25(33-36(11,12)30(2,3)4)21-22-27-26(20-18-23-35(8,9)10)28(32)24-29(27)34-37(13,14)31(5,6)7/h21-22,25-27,29H,15-17,19-20,24H2,1-14H3/b22-21+/t25-,26+,27+,29+/m0/s1 |
| InChIKey | RFYILRCRHOUIGY-WWFDXTQCSA-N |
| XLogP | 9.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.08 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|