C17H22N4O2 — CID 109299782
N-ethyl-2-(2-methoxyethylamino)-N-(3-methylphenyl)pyrimidine-4-carboxamide (PubChem CID 109299782) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-ethyl-2-(2-methoxyethylamino)-N-(3-methylphenyl)pyrimidine-4-carboxamide.
| Compound Name | N-ethyl-2-(2-methoxyethylamino)-N-(3-methylphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109299782 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-ethyl-2-(2-methoxyethylamino)-N-(3-methylphenyl)pyrimidine-4-carboxamide |
| SMILES | CCN(C(=O)c1ccnc(NCCOC)n1)c1cccc(C)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-4-21(14-7-5-6-13(2)12-14)16(22)15-8-9-18-17(20-15)19-10-11-23-3/h5-9,12H,4,10-11H2,1-3H3,(H,18,19,20) |
| InChIKey | ZVRHLKCAHWUTMC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|