C26H31IN2O4Si — CID 10930007
1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10930007) has the molecular formula C26H31IN2O4Si and a molecular weight of 590.53 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10930007 |
| Molecular Formula | C26H31IN2O4Si |
| Molecular Weight | 590.53 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 1-[(2R,4S,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](CI)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H31IN2O4Si/c1-18-17-29(25(31)28-24(18)30)23-15-21(22(16-27)32-23)33-34(26(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,17,21-23H,15-16H2,1-4H3,(H,28,30,31)/t21-,22+,23+/m0/s1 |
| InChIKey | IKLBTHGVTYEFQP-YTFSRNRJSA-N |
| XLogP | 3.51 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|