C27H47BrO7Si — CID 10930012
methyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate (PubChem CID 10930012) has the molecular formula C27H47BrO7Si and a molecular weight of 591.66 g/mol. Its IUPAC name is methyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 10930012 |
| Molecular Formula | C27H47BrO7Si |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | methyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(OC)C[C@H](OC)C[C@H]([C@@H](/C=C(C)/C=C/[C@@H](C/C=C/Br)OC)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H47BrO7Si/c1-20(13-14-21(30-5)12-11-15-28)16-24(35-36(9,10)26(2,3)4)23-17-22(31-6)18-27(33-8,34-23)19-25(29)32-7/h11,13-16,21-24H,12,17-19H2,1-10H3/b14-13+,15-11+,20-16+/t21-,22-,23-,24-,27+/m1/s1 |
| InChIKey | HZULMFJXOLPAIX-ASVOIWFASA-N |
| XLogP | 6.29 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|