C16H16N4O4 — CID 109300487
N-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide (PubChem CID 109300487) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109300487 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H16N4O4/c21-15(18-11-1-2-13-14(9-11)24-10-23-13)12-3-4-17-16(19-12)20-5-7-22-8-6-20/h1-4,9H,5-8,10H2,(H,18,21) |
| InChIKey | SXECZDZUBVTZSJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |