C39H48O3SSi — CID 10930181
(5S,6R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one (PubChem CID 10930181) has the molecular formula C39H48O3SSi and a molecular weight of 624.96 g/mol. Its IUPAC name is (5S,6R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one.
| Compound Name | (5S,6R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10930181 |
| Molecular Formula | C39H48O3SSi |
| Molecular Weight | 624.96 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | (5S,6R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-methylpropoxy)-6-[(3E)-4-phenylsulfanylhexa-3,5-dienyl]cyclohex-2-en-1-one |
| SMILES | C=C/C(=C\CC[C@H]1C(=O)C=C(OCC(C)C)C[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C39H48O3SSi/c1-7-33(43-34-18-11-8-12-19-34)20-17-25-37-31(26-32(27-38(37)40)41-28-30(2)3)29-42-44(39(4,5)6,35-21-13-9-14-22-35)36-23-15-10-16-24-36/h7-16,18-24,27,30-31,37H,1,17,25-26,28-29H2,2-6H3/b33-20+/t31-,37-/m1/s1 |
| InChIKey | TVZSXYMXMZKNFR-AWIUOUECSA-N |
| XLogP | 8.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.96 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|