About [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate
[4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate (PubChem CID 10930244) has the molecular formula C32H26O10S2
and a molecular weight of 634.68 g/mol. Its IUPAC name is [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate.
Molecular Properties
| Compound Name | [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate |
| PubChem CID | 10930244 |
| Molecular Formula | C32H26O10S2 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate |
| SMILES | CC(=O)OC(C#CC(OC(C)=O)c1ccc(OS(=O)(=O)c2ccccc2)cc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H26O10S2/c1-23(33)39-31(25-13-17-27(18-14-25)41-43(35,36)29-9-5-3-6-10-29)21-22-32(40-24(2)34)26-15-19-28(20-16-26)42-44(37,38)30-11-7-4-8-12-30/h3-20,31-32H,1-2H3 |
| InChIKey | ILJWMEOHEGDEJW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate?
The IUPAC name of [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate (CID 10930244) is [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate.
What is the SMILES notation for [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate?
The canonical SMILES for [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate is CC(=O)OC(C#CC(OC(C)=O)c1ccc(OS(=O)(=O)c2ccccc2)cc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate?
The InChIKey is ILJWMEOHEGDEJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H26O10S2/c1-23(33)39-31(25-13-17-27(18-14-25)41-43(35,36)29-9-5-3-6-10-29)21-22-32(40-24(2)34)26-15-19-28(20-16-26)42-44(37,38)30-11-7-4-8-12-30/h3-20,31-32H,1-2H3.
What are the key properties of [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate?
[4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate has a molecular weight of 634.68 g/mol, XLogP of 5.13, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-acetyloxy-1,4-bis[4-(benzenesulfonyloxy)phenyl]but-2-ynyl] acetate is sourced from PubChem (CID 10930244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).