C19H26N6O — CID 109302642
[2-[4-(dimethylamino)anilino]pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 109302642) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [2-[4-(dimethylamino)anilino]pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109302642 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2ccnc(Nc3ccc(N(C)C)cc3)n2)CC1 |
| InChI | InChI=1S/C19H26N6O/c1-4-24-11-13-25(14-12-24)18(26)17-9-10-20-19(22-17)21-15-5-7-16(8-6-15)23(2)3/h5-10H,4,11-14H2,1-3H3,(H,20,21,22) |
| InChIKey | GDSPLEAEIGCSPJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|