C21H28N6O2 — CID 109302967
4-[2-[4-(diethylamino)-2-methylanilino]pyrimidine-4-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109302967) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-[2-[4-(diethylamino)-2-methylanilino]pyrimidine-4-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-[4-(diethylamino)-2-methylanilino]pyrimidine-4-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109302967 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-[2-[4-(diethylamino)-2-methylanilino]pyrimidine-4-carbonyl]piperazine-1-carbaldehyde |
| SMILES | CCN(CC)c1ccc(Nc2nccc(C(=O)N3CCN(C=O)CC3)n2)c(C)c1 |
| InChI | InChI=1S/C21H28N6O2/c1-4-26(5-2)17-6-7-18(16(3)14-17)23-21-22-9-8-19(24-21)20(29)27-12-10-25(15-28)11-13-27/h6-9,14-15H,4-5,10-13H2,1-3H3,(H,22,23,24) |
| InChIKey | KBJMIZGEYGLBOZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|