C39H56O6Si — CID 10930304
(1S,5S,9R,10S,13R,14S,15R)-13-[tert-butyl(dimethyl)silyl]oxy-3,3,12,12,15-pentamethyl-8-methylidene-10,14-bis(phenylmethoxy)-2,4-dioxatricyclo[7.5.1.05,15]pentadecan-11-one (PubChem CID 10930304) has the molecular formula C39H56O6Si and a molecular weight of 648.96 g/mol. Its IUPAC name is (1S,5S,9R,10S,13R,14S,15R)-13-[tert-butyl(dimethyl)silyl]oxy-3,3,12,12,15-pentamethyl-8-methylidene-10,14-bis(phenylmethoxy)-2,4-dioxatricyclo[7.5.1.05,15]pentadecan-11-one.
| Compound Name | (1S,5S,9R,10S,13R,14S,15R)-13-[tert-butyl(dimethyl)silyl]oxy-3,3,12,12,15-pentamethyl-8-methylidene-10,14-bis(phenylmethoxy)-2,4-dioxatricyclo[7.5.1.05,15]pentadecan-11-one |
|---|---|
| PubChem CID | 10930304 |
| Molecular Formula | C39H56O6Si |
| Molecular Weight | 648.96 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | (1S,5S,9R,10S,13R,14S,15R)-13-[tert-butyl(dimethyl)silyl]oxy-3,3,12,12,15-pentamethyl-8-methylidene-10,14-bis(phenylmethoxy)-2,4-dioxatricyclo[7.5.1.05,15]pentadecan-11-one |
| SMILES | C=C1CC[C@@H]2OC(C)(C)O[C@@H]3[C@H](OCc4ccccc4)[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@@H](OCc4ccccc4)[C@H]1[C@]23C |
| InChI | InChI=1S/C39H56O6Si/c1-26-22-23-29-39(9)30(26)31(41-24-27-18-14-12-15-19-27)33(40)37(5,6)34(45-46(10,11)36(2,3)4)32(35(39)44-38(7,8)43-29)42-25-28-20-16-13-17-21-28/h12-21,29-32,34-35H,1,22-25H2,2-11H3/t29-,30-,31-,32+,34-,35+,39-/m0/s1 |
| InChIKey | YHNOMPAPKTZEKW-HHBIZPKCSA-N |
| XLogP | 8.65 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.96 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|