C37H62O9 — CID 10930313
(2S)-4-[(2R,13S)-2-hydroxy-13-(methoxymethoxy)-14-[2-[(2S)-2-(methoxymethoxy)dodecoxy]ethoxy]tetradeca-4,10-diynyl]-2-methyl-2H-furan-5-one (PubChem CID 10930313) has the molecular formula C37H62O9 and a molecular weight of 650.89 g/mol. Its IUPAC name is (2S)-4-[(2R,13S)-2-hydroxy-13-(methoxymethoxy)-14-[2-[(2S)-2-(methoxymethoxy)dodecoxy]ethoxy]tetradeca-4,10-diynyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(2R,13S)-2-hydroxy-13-(methoxymethoxy)-14-[2-[(2S)-2-(methoxymethoxy)dodecoxy]ethoxy]tetradeca-4,10-diynyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10930313 |
| Molecular Formula | C37H62O9 |
| Molecular Weight | 650.89 g/mol |
| Exact Mass | 650.44 |
| IUPAC Name | (2S)-4-[(2R,13S)-2-hydroxy-13-(methoxymethoxy)-14-[2-[(2S)-2-(methoxymethoxy)dodecoxy]ethoxy]tetradeca-4,10-diynyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCCCCCC[C@@H](COCCOC[C@H](CC#CCCCCC#CC[C@@H](O)CC1=C[C@H](C)OC1=O)OCOC)OCOC |
| InChI | InChI=1S/C37H62O9/c1-5-6-7-8-9-13-16-19-22-35(44-30-40-3)28-42-24-25-43-29-36(45-31-41-4)23-20-17-14-11-10-12-15-18-21-34(38)27-33-26-32(2)46-37(33)39/h26,32,34-36,38H,5-14,16,19,21-25,27-31H2,1-4H3/t32-,34+,35-,36-/m0/s1 |
| InChIKey | JOYQIPQIXNFYKD-RKKBZCJMSA-N |
| XLogP | 6.50 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.89 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|