C16H12Cl2N4O2 — CID 109303404
N-(2,3-dichlorophenyl)-2-(furan-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109303404) has the molecular formula C16H12Cl2N4O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(furan-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(furan-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109303404 |
| Molecular Formula | C16H12Cl2N4O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(furan-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccnc(NCc2ccco2)n1 |
| InChI | InChI=1S/C16H12Cl2N4O2/c17-11-4-1-5-12(14(11)18)21-15(23)13-6-7-19-16(22-13)20-9-10-3-2-8-24-10/h1-8H,9H2,(H,21,23)(H,19,20,22) |
| InChIKey | LDPWGUXHOFWQHA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |