C35H41F3O7SSi — CID 10930472
methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[[(1R,6S)-1,6-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]methyl]-5-methoxybenzoate (PubChem CID 10930472) has the molecular formula C35H41F3O7SSi and a molecular weight of 690.85 g/mol. Its IUPAC name is methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[[(1R,6S)-1,6-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]methyl]-5-methoxybenzoate.
| Compound Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[[(1R,6S)-1,6-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]methyl]-5-methoxybenzoate |
|---|---|
| PubChem CID | 10930472 |
| Molecular Formula | C35H41F3O7SSi |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.23 |
| IUPAC Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-4-[[(1R,6S)-1,6-dimethyl-2-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-yl]methyl]-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(C[C@@]2(C)C(OS(=O)(=O)C(F)(F)F)=CCC[C@@H]2C)c(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C35H41F3O7SSi/c1-24-15-14-20-31(44-46(40,41)35(36,37)38)34(24,5)23-28-29(42-6)21-25(32(39)43-7)22-30(28)45-47(33(2,3)4,26-16-10-8-11-17-26)27-18-12-9-13-19-27/h8-13,16-22,24H,14-15,23H2,1-7H3/t24-,34+/m0/s1 |
| InChIKey | UNEGPHKVAVQTFR-YUYWZBKDSA-N |
| XLogP | 7.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|