C20H20N4O2 — CID 109304794
N-(2-methoxyphenyl)-2-(1-phenylethylamino)pyrimidine-4-carboxamide (PubChem CID 109304794) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-(1-phenylethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-2-(1-phenylethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109304794 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(2-methoxyphenyl)-2-(1-phenylethylamino)pyrimidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ccnc(NC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4O2/c1-14(15-8-4-3-5-9-15)22-20-21-13-12-17(24-20)19(25)23-16-10-6-7-11-18(16)26-2/h3-14H,1-2H3,(H,23,25)(H,21,22,24) |
| InChIKey | FOQFGZBWCNCKAT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |