C21H21ClN4O — CID 109304923
2-(2-chloro-4,6-dimethylanilino)-N-(1-phenylethyl)pyrimidine-4-carboxamide (PubChem CID 109304923) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-(2-chloro-4,6-dimethylanilino)-N-(1-phenylethyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(2-chloro-4,6-dimethylanilino)-N-(1-phenylethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109304923 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-(2-chloro-4,6-dimethylanilino)-N-(1-phenylethyl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C)c(Nc2nccc(C(=O)NC(C)c3ccccc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClN4O/c1-13-11-14(2)19(17(22)12-13)26-21-23-10-9-18(25-21)20(27)24-15(3)16-7-5-4-6-8-16/h4-12,15H,1-3H3,(H,24,27)(H,23,25,26) |
| InChIKey | VKQISFJPTBYXBJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |