C20H18ClN5O2 — CID 109305822
N-(3-acetamidophenyl)-2-[(2-chlorophenyl)methylamino]pyrimidine-4-carboxamide (PubChem CID 109305822) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[(2-chlorophenyl)methylamino]pyrimidine-4-carboxamide.
| Compound Name | N-(3-acetamidophenyl)-2-[(2-chlorophenyl)methylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109305822 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[(2-chlorophenyl)methylamino]pyrimidine-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2ccnc(NCc3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C20H18ClN5O2/c1-13(27)24-15-6-4-7-16(11-15)25-19(28)18-9-10-22-20(26-18)23-12-14-5-2-3-8-17(14)21/h2-11H,12H2,1H3,(H,24,27)(H,25,28)(H,22,23,26) |
| InChIKey | FHQBGXCXVBASQZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |