C20H18F2N4O — CID 109306779
2-[benzyl(ethyl)amino]-N-(3,4-difluorophenyl)pyrimidine-4-carboxamide (PubChem CID 109306779) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-N-(3,4-difluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-[benzyl(ethyl)amino]-N-(3,4-difluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109306779 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-N-(3,4-difluorophenyl)pyrimidine-4-carboxamide |
| SMILES | CCN(Cc1ccccc1)c1nccc(C(=O)Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C20H18F2N4O/c1-2-26(13-14-6-4-3-5-7-14)20-23-11-10-18(25-20)19(27)24-15-8-9-16(21)17(22)12-15/h3-12H,2,13H2,1H3,(H,24,27) |
| InChIKey | BIDSGBFQQGHOLI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |