C18H24N4O2 — CID 109308681
N,N-diethyl-2-[2-(3-methoxyphenyl)ethylamino]pyrimidine-4-carboxamide (PubChem CID 109308681) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(3-methoxyphenyl)ethylamino]pyrimidine-4-carboxamide.
| Compound Name | N,N-diethyl-2-[2-(3-methoxyphenyl)ethylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109308681 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N,N-diethyl-2-[2-(3-methoxyphenyl)ethylamino]pyrimidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccnc(NCCc2cccc(OC)c2)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-4-22(5-2)17(23)16-10-12-20-18(21-16)19-11-9-14-7-6-8-15(13-14)24-3/h6-8,10,12-13H,4-5,9,11H2,1-3H3,(H,19,20,21) |
| InChIKey | UBTOQNIQENHCRV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |