C23H31N5O — CID 109310482
N-pentyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidine-4-carboxamide (PubChem CID 109310482) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is N-pentyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidine-4-carboxamide.
| Compound Name | N-pentyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109310482 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-pentyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidine-4-carboxamide |
| SMILES | CCCCCNC(=O)c1ccnc(N2CCN(C/C=C/c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H31N5O/c1-2-3-7-13-24-22(29)21-12-14-25-23(26-21)28-18-16-27(17-19-28)15-8-11-20-9-5-4-6-10-20/h4-6,8-12,14H,2-3,7,13,15-19H2,1H3,(H,24,29)/b11-8+ |
| InChIKey | FQPIHGLZHLPSDI-DHZHZOJOSA-N |
| XLogP | 3.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|