C24H28N4O — CID 109310973
N-(2-tert-butylphenyl)-2-(3-phenylpropylamino)pyrimidine-4-carboxamide (PubChem CID 109310973) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2-(3-phenylpropylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-2-(3-phenylpropylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109310973 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-(2-tert-butylphenyl)-2-(3-phenylpropylamino)pyrimidine-4-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)c1ccnc(NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C24H28N4O/c1-24(2,3)19-13-7-8-14-20(19)27-22(29)21-15-17-26-23(28-21)25-16-9-12-18-10-5-4-6-11-18/h4-8,10-11,13-15,17H,9,12,16H2,1-3H3,(H,27,29)(H,25,26,28) |
| InChIKey | PVTGNIHQEHXVSF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|