C19H26N4O — CID 109311340
N-tert-butyl-2-(2,6-diethylanilino)pyrimidine-4-carboxamide (PubChem CID 109311340) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is N-tert-butyl-2-(2,6-diethylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-tert-butyl-2-(2,6-diethylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109311340 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-tert-butyl-2-(2,6-diethylanilino)pyrimidine-4-carboxamide |
| SMILES | CCc1cccc(CC)c1Nc1nccc(C(=O)NC(C)(C)C)n1 |
| InChI | InChI=1S/C19H26N4O/c1-6-13-9-8-10-14(7-2)16(13)22-18-20-12-11-15(21-18)17(24)23-19(3,4)5/h8-12H,6-7H2,1-5H3,(H,23,24)(H,20,21,22) |
| InChIKey | BCHLPMRMOUIHST-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |