C23H24N4O2 — CID 109311663
N-(3-acetylphenyl)-2-[benzyl(propan-2-yl)amino]pyrimidine-4-carboxamide (PubChem CID 109311663) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[benzyl(propan-2-yl)amino]pyrimidine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2-[benzyl(propan-2-yl)amino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109311663 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-(3-acetylphenyl)-2-[benzyl(propan-2-yl)amino]pyrimidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccnc(N(Cc3ccccc3)C(C)C)n2)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-16(2)27(15-18-8-5-4-6-9-18)23-24-13-12-21(26-23)22(29)25-20-11-7-10-19(14-20)17(3)28/h4-14,16H,15H2,1-3H3,(H,25,29) |
| InChIKey | BDEAKRYIYUQYJW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |