C18F30I3N3 — CID 10931235
2,4,6-tris(1,1,2,2,3,3,4,4,5,5-decafluoro-5-iodopentyl)-1,3,5-triazine (PubChem CID 10931235) has the molecular formula C18F30I3N3 and a molecular weight of 1208.87 g/mol. Its IUPAC name is 2,4,6-tris(1,1,2,2,3,3,4,4,5,5-decafluoro-5-iodopentyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(1,1,2,2,3,3,4,4,5,5-decafluoro-5-iodopentyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 10931235 |
| Molecular Formula | C18F30I3N3 |
| Molecular Weight | 1208.87 g/mol |
| Exact Mass | 1208.67 |
| IUPAC Name | 2,4,6-tris(1,1,2,2,3,3,4,4,5,5-decafluoro-5-iodopentyl)-1,3,5-triazine |
| SMILES | FC(F)(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1nc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I)nc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I)n1 |
| InChI | InChI=1S/C18F30I3N3/c19-4(20,7(25,26)10(31,32)13(37,38)16(43,44)49)1-52-2(5(21,22)8(27,28)11(33,34)14(39,40)17(45,46)50)54-3(53-1)6(23,24)9(29,30)12(35,36)15(41,42)18(47,48)51 |
| InChIKey | LOYHRIYWZWAPDH-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1208.87 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|