C18H14Cl2N4O — CID 109313884
N-(2,3-dichlorophenyl)-2-(3-methylanilino)pyrimidine-4-carboxamide (PubChem CID 109313884) has the molecular formula C18H14Cl2N4O and a molecular weight of 373.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(3-methylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(3-methylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109313884 |
| Molecular Formula | C18H14Cl2N4O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(3-methylanilino)pyrimidine-4-carboxamide |
| SMILES | Cc1cccc(Nc2nccc(C(=O)Nc3cccc(Cl)c3Cl)n2)c1 |
| InChI | InChI=1S/C18H14Cl2N4O/c1-11-4-2-5-12(10-11)22-18-21-9-8-15(24-18)17(25)23-14-7-3-6-13(19)16(14)20/h2-10H,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | OHQKIIAWCFKXIH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |