C8H14O — CID 10931443
(1R,2S,6S)-6-methylbicyclo[4.1.0]heptan-2-ol (PubChem CID 10931443) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (1R,2S,6S)-6-methylbicyclo[4.1.0]heptan-2-ol.
| Compound Name | (1R,2S,6S)-6-methylbicyclo[4.1.0]heptan-2-ol |
|---|---|
| PubChem CID | 10931443 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (1R,2S,6S)-6-methylbicyclo[4.1.0]heptan-2-ol |
| SMILES | C[C@@]12CCC[C@H](O)[C@@H]1C2 |
| InChI | InChI=1S/C8H14O/c1-8-4-2-3-7(9)6(8)5-8/h6-7,9H,2-5H2,1H3/t6-,7-,8-/m0/s1 |
| InChIKey | IYHFQMCKRKRGHN-FXQIFTODSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |