C5H10O4 — CID 10931473
(2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10931473) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10931473 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H10O4/c6-1-4-5(8)3(7)2-9-4/h3-8H,1-2H2/t3-,4+,5-/m0/s1 |
| InChIKey | KZVAAIRBJJYZOW-LMVFSUKVSA-N |
| XLogP | -1.90 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |