About CID 10931479
CID 10931479 (PubChem CID 10931479) has the molecular formula C10H9
and a molecular weight of 129.18 g/mol.
Molecular Properties
| Compound Name | CID 10931479 |
| PubChem CID | 10931479 |
| Molecular Formula | C10H9 |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | — |
| SMILES | CC1=Cc2ccccc2[CH]1 |
| InChI | InChI=1S/C10H9/c1-8-6-9-4-2-3-5-10(9)7-8/h2-7H,1H3 |
| InChIKey | JUMFQVMCKQKWRG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 10931479 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10931479?
The IUPAC name of CID 10931479 (CID 10931479) is not available.
What is the SMILES notation for CID 10931479?
The canonical SMILES for CID 10931479 is CC1=Cc2ccccc2[CH]1.
What is the InChIKey of CID 10931479?
The InChIKey is JUMFQVMCKQKWRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9/c1-8-6-9-4-2-3-5-10(9)7-8/h2-7H,1H3.
What are the key properties of CID 10931479?
CID 10931479 has a molecular weight of 129.18 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10931479 is sourced from PubChem (CID 10931479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).