C21H20N4O3 — CID 109315289
methyl 4-[[2-(2,6-dimethylanilino)pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 109315289) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is methyl 4-[[2-(2,6-dimethylanilino)pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2,6-dimethylanilino)pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109315289 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | methyl 4-[[2-(2,6-dimethylanilino)pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccnc(Nc3c(C)cccc3C)n2)cc1 |
| InChI | InChI=1S/C21H20N4O3/c1-13-5-4-6-14(2)18(13)25-21-22-12-11-17(24-21)19(26)23-16-9-7-15(8-10-16)20(27)28-3/h4-12H,1-3H3,(H,23,26)(H,22,24,25) |
| InChIKey | IGODHSUGPQUOIQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |