C21H20N4O3 — CID 109315827
methyl 4-[[2-(N-ethylanilino)pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 109315827) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is methyl 4-[[2-(N-ethylanilino)pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(N-ethylanilino)pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109315827 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | methyl 4-[[2-(N-ethylanilino)pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | CCN(c1ccccc1)c1nccc(C(=O)Nc2ccc(C(=O)OC)cc2)n1 |
| InChI | InChI=1S/C21H20N4O3/c1-3-25(17-7-5-4-6-8-17)21-22-14-13-18(24-21)19(26)23-16-11-9-15(10-12-16)20(27)28-2/h4-14H,3H2,1-2H3,(H,23,26) |
| InChIKey | IQWJZTHOKKWDHT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |